Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 98796-51-1, Name is 5′-O-[Bis(4-Methoxyphenyl)phenylmethyl]-thymidine 3′-[2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite], SMILES is O=C(NC(C(C)=C1)=O)N1[C@H](O2)C[C@H](OP(N(C(C)C)C(C)C)OCCC#N)[C@H]2COC(C3=CC=C(OC)C=C3)(C4=CC=C(OC)C=C4)C5=CC=CC=C5, belongs to naphthyridines compound. In a document, author is Park, T, introduce the new discover, Formula: C40H49N4O8P.
Preparation of 2,7-diamino-1,8-naphthyridine: A useful building block for supramolecular chemistry
A two-step conversion of 2-chloro-7-ainido-1,8-naplithyridine to 2.7-diamino-1,8-naphthyridine is described. The process, which involves a nucleophilic aromatic substitution reaction with 4-methoxybenzylamine and subsequent deprotection, can be carried out on a large scale.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 98796-51-1 is helpful to your research. Formula: C40H49N4O8P.
Reference:
1,8-Naphthyridine – Wikipedia,
,1,8-Naphthyridine | C8H6N2 – PubChem